Description
An oxopurine that is guanine in which the hydrogen at position 8 is replaced by an oxo group and in which the nitrogens at positions 7 and 9 each bear a hydrogen.
Chemical properties
| Chemical formula | Net charge | Average mass |
|---|---|---|
| C5H5N5O2 | 0 | 167.12550 |
Recommended notation
| Name | 8-oxoguanine |
|---|---|
| Abbreviation | 8oxoG |
| Symbol | o |
Nomenclature
| IUPAC | SMILES | InChI | InChIKey | Synonyms |
|---|---|---|---|---|
| 2-amino-7,9-dihydro-1H-purine-6,8-dione | Nc1nc2[nH]c(=O)[nH]c2c(=O)[nH]1 | InChI=1S/C5H5N5O2/c6-4-8-2-1(3(11)10-4)7-5(12)9-2/h(H5,6,7,8,9,10,11,12) | CLGFIVUFZRGQRP-UHFFFAOYSA-N |
|